C22H25BrN2O4S — CID 112762584
1-(4-acetylphenyl)sulfonyl-N-[1-(2-bromophenyl)ethyl]piperidine-4-carboxamide (PubChem CID 112762584) has the molecular formula C22H25BrN2O4S and a molecular weight of 493.42 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-N-[1-(2-bromophenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-N-[1-(2-bromophenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112762584 |
| Molecular Formula | C22H25BrN2O4S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-N-[1-(2-bromophenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)NC(C)c3ccccc3Br)CC2)cc1 |
| InChI | InChI=1S/C22H25BrN2O4S/c1-15(20-5-3-4-6-21(20)23)24-22(27)18-11-13-25(14-12-18)30(28,29)19-9-7-17(8-10-19)16(2)26/h3-10,15,18H,11-14H2,1-2H3,(H,24,27) |
| InChIKey | GUBCPXNZQWFHLR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |