C21H22F3NO3 — CID 112763961
2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 112763961) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 112763961 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-N-[1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | C/C=C/c1ccc(OCC(=O)NC(C)c2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H22F3NO3/c1-4-6-15-9-10-18(19(11-15)27-3)28-13-20(26)25-14(2)16-7-5-8-17(12-16)21(22,23)24/h4-12,14H,13H2,1-3H3,(H,25,26)/b6-4+ |
| InChIKey | FOIGEFYLUXOYSX-GQCTYLIASA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |