C18H17BrF2N2O3 — CID 112768433
N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]-2-(difluoromethoxy)benzamide (PubChem CID 112768433) has the molecular formula C18H17BrF2N2O3 and a molecular weight of 427.25 g/mol. Its IUPAC name is N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]-2-(difluoromethoxy)benzamide.
| Compound Name | N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 112768433 |
| Molecular Formula | C18H17BrF2N2O3 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | N-[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl]-2-(difluoromethoxy)benzamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CNC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C18H17BrF2N2O3/c1-23(11-12-6-2-4-8-14(12)19)16(24)10-22-17(25)13-7-3-5-9-15(13)26-18(20)21/h2-9,18H,10-11H2,1H3,(H,22,25) |
| InChIKey | LGZBCAVFOZPQQH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |