C12H24O4Si — CID 11276976
prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropanoate (PubChem CID 11276976) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropanoate.
| Compound Name | prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropanoate |
|---|---|
| PubChem CID | 11276976 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | prop-2-enyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropanoate |
| SMILES | C=CCOC(=O)[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O4Si/c1-7-8-15-11(14)10(9-13)16-17(5,6)12(2,3)4/h7,10,13H,1,8-9H2,2-6H3/t10-/m0/s1 |
| InChIKey | GDHPWUSKLVHAIA-JTQLQIEISA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|