C15H28O4Si — CID 15350846
methyl 2-[(2S)-but-3-en-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxybut-3-enoate (PubChem CID 15350846) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is methyl 2-[(2S)-but-3-en-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxybut-3-enoate.
| Compound Name | methyl 2-[(2S)-but-3-en-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxybut-3-enoate |
|---|---|
| PubChem CID | 15350846 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | methyl 2-[(2S)-but-3-en-2-yl]oxy-3-[tert-butyl(dimethyl)silyl]oxybut-3-enoate |
| SMILES | C=C[C@H](C)OC(C(=C)O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C15H28O4Si/c1-10-11(2)18-13(14(16)17-7)12(3)19-20(8,9)15(4,5)6/h10-11,13H,1,3H2,2,4-9H3/t11-,13?/m0/s1 |
| InChIKey | YAMKIBIEWQPNGC-AMGKYWFPSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|