C15H22O4 — CID 11277116
(1R,4R,9S,12S,13R)-7,13-dimethyl-2,10-dioxatetracyclo[10.2.1.04,9.04,13]pentadec-7-ene-1,12-diol (PubChem CID 11277116) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,4R,9S,12S,13R)-7,13-dimethyl-2,10-dioxatetracyclo[10.2.1.04,9.04,13]pentadec-7-ene-1,12-diol.
| Compound Name | (1R,4R,9S,12S,13R)-7,13-dimethyl-2,10-dioxatetracyclo[10.2.1.04,9.04,13]pentadec-7-ene-1,12-diol |
|---|---|
| PubChem CID | 11277116 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,4R,9S,12S,13R)-7,13-dimethyl-2,10-dioxatetracyclo[10.2.1.04,9.04,13]pentadec-7-ene-1,12-diol |
| SMILES | CC1=C[C@@H]2OC[C@]3(O)C[C@@]4(O)C[C@]3(C)[C@]2(CC1)CO4 |
| InChI | InChI=1S/C15H22O4/c1-10-3-4-13-8-19-15(17)6-12(13,2)14(16,7-15)9-18-11(13)5-10/h5,11,16-17H,3-4,6-9H2,1-2H3/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | SJLDRXNKLNZPDF-NJVJYBDUSA-N |
| XLogP | 1.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|