C15H20O4 — CID 72770923
2-hydroxy-6,10-dimethyl-3,14-dioxatetracyclo[7.4.2.01,10.04,9]pentadec-5-en-12-one (PubChem CID 72770923) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-hydroxy-6,10-dimethyl-3,14-dioxatetracyclo[7.4.2.01,10.04,9]pentadec-5-en-12-one.
| Compound Name | 2-hydroxy-6,10-dimethyl-3,14-dioxatetracyclo[7.4.2.01,10.04,9]pentadec-5-en-12-one |
|---|---|
| PubChem CID | 72770923 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-hydroxy-6,10-dimethyl-3,14-dioxatetracyclo[7.4.2.01,10.04,9]pentadec-5-en-12-one |
| SMILES | CC1=CC2OC(O)C34CC(=O)CC3(C)C2(CC1)CO4 |
| InChI | InChI=1S/C15H20O4/c1-9-3-4-14-8-18-15(12(17)19-11(14)5-9)7-10(16)6-13(14,15)2/h5,11-12,17H,3-4,6-8H2,1-2H3 |
| InChIKey | UDFBADFSSIEMAL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|