C17H20Cl2O5 — CID 54053295
[(1R,2R,7R,9S,12S)-1,5-dimethyl-10-oxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,2-dichloroacetate (PubChem CID 54053295) has the molecular formula C17H20Cl2O5 and a molecular weight of 375.25 g/mol. Its IUPAC name is [(1R,2R,7R,9S,12S)-1,5-dimethyl-10-oxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,2-dichloroacetate.
| Compound Name | [(1R,2R,7R,9S,12S)-1,5-dimethyl-10-oxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,2-dichloroacetate |
|---|---|
| PubChem CID | 54053295 |
| Molecular Formula | C17H20Cl2O5 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [(1R,2R,7R,9S,12S)-1,5-dimethyl-10-oxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl 2,2-dichloroacetate |
| SMILES | CC1=C[C@H]2O[C@@H]3C(=O)C[C@](C)([C@@]2(COC(=O)C(Cl)Cl)CC1)[C@]31CO1 |
| InChI | InChI=1S/C17H20Cl2O5/c1-9-3-4-16(7-22-14(21)13(18)19)11(5-9)24-12-10(20)6-15(16,2)17(12)8-23-17/h5,11-13H,3-4,6-8H2,1-2H3/t11-,12-,15-,16-,17+/m1/s1 |
| InChIKey | LULVOLUZLBSMEK-NKMGPIEYSA-N |
| XLogP | 2.58 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|