C19H22O8 — CID 21140834
[(1S,2R,7R,9S,12S)-11-acetyloxy-1,5-dimethyl-4,10-dioxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl acetate (PubChem CID 21140834) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is [(1S,2R,7R,9S,12S)-11-acetyloxy-1,5-dimethyl-4,10-dioxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl acetate.
| Compound Name | [(1S,2R,7R,9S,12S)-11-acetyloxy-1,5-dimethyl-4,10-dioxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl acetate |
|---|---|
| PubChem CID | 21140834 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(1S,2R,7R,9S,12S)-11-acetyloxy-1,5-dimethyl-4,10-dioxospiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CC(=O)C(C)=C[C@H]1O[C@@H]1C(=O)C(OC(C)=O)[C@@]2(C)[C@]12CO2 |
| InChI | InChI=1S/C19H22O8/c1-9-5-13-18(6-12(9)22,7-24-10(2)20)17(4)15(26-11(3)21)14(23)16(27-13)19(17)8-25-19/h5,13,15-16H,6-8H2,1-4H3/t13-,15?,16-,17-,18-,19+/m1/s1 |
| InChIKey | DQSOKUXXNKVRAY-UMPNQEFTSA-N |
| XLogP | 0.51 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|