C15H24O3 — CID 75051998
7,9a,9b-trimethyl-2,3,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromene-2,3a-diol (PubChem CID 75051998) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 7,9a,9b-trimethyl-2,3,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromene-2,3a-diol.
| Compound Name | 7,9a,9b-trimethyl-2,3,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromene-2,3a-diol |
|---|---|
| PubChem CID | 75051998 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 7,9a,9b-trimethyl-2,3,4,5a,8,9-hexahydro-1H-cyclopenta[c]chromene-2,3a-diol |
| SMILES | CC1=CC2OCC3(O)CC(O)CC3(C)C2(C)CC1 |
| InChI | InChI=1S/C15H24O3/c1-10-4-5-13(2)12(6-10)18-9-15(17)8-11(16)7-14(13,15)3/h6,11-12,16-17H,4-5,7-9H2,1-3H3 |
| InChIKey | QRDSKOBGOKEIEV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|