C18H31NO — CID 112771455
N-butyl-N,3,5-trimethyladamantane-1-carboxamide (PubChem CID 112771455) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is N-butyl-N,3,5-trimethyladamantane-1-carboxamide.
| Compound Name | N-butyl-N,3,5-trimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 112771455 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-butyl-N,3,5-trimethyladamantane-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H31NO/c1-5-6-7-19(4)15(20)18-10-14-8-16(2,12-18)11-17(3,9-14)13-18/h14H,5-13H2,1-4H3 |
| InChIKey | KBPMQMJLDAFGAD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |