C18H30ClNO — CID 107205563
N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide (PubChem CID 107205563) has the molecular formula C18H30ClNO and a molecular weight of 311.90 g/mol. Its IUPAC name is N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide.
| Compound Name | N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 107205563 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide |
| SMILES | CN(CCCCCCl)C(=O)C12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H30ClNO/c1-17-9-14-8-15(10-17)12-18(11-14,13-17)16(21)20(2)7-5-3-4-6-19/h14-15H,3-13H2,1-2H3 |
| InChIKey | HXZAVEFFVXVISD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|