About N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide
N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide (PubChem CID 107205563) has the molecular formula C18H30ClNO
and a molecular weight of 311.90 g/mol. Its IUPAC name is N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide |
| PubChem CID | 107205563 |
| Molecular Formula | C18H30ClNO |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide |
| SMILES | CN(CCCCCCl)C(=O)C12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H30ClNO/c1-17-9-14-8-15(10-17)12-18(11-14,13-17)16(21)20(2)7-5-3-4-6-19/h14-15H,3-13H2,1-2H3 |
| InChIKey | HXZAVEFFVXVISD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide?
The IUPAC name of N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide (CID 107205563) is N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide.
What is the SMILES notation for N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide?
The canonical SMILES for N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide is CN(CCCCCCl)C(=O)C12CC3CC(CC(C)(C3)C1)C2.
What is the InChIKey of N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide?
The InChIKey is HXZAVEFFVXVISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30ClNO/c1-17-9-14-8-15(10-17)12-18(11-14,13-17)16(21)20(2)7-5-3-4-6-19/h14-15H,3-13H2,1-2H3.
What are the key properties of N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide?
N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide has a molecular weight of 311.90 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloropentyl)-N,3-dimethyladamantane-1-carboxamide is sourced from PubChem (CID 107205563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).