C20H19N3O3S2 — CID 112772045
N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-ethylsulfinylbenzamide (PubChem CID 112772045) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-ethylsulfinylbenzamide.
| Compound Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-ethylsulfinylbenzamide |
|---|---|
| PubChem CID | 112772045 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]-2-ethylsulfinylbenzamide |
| SMILES | CCS(=O)c1ccccc1C(=O)Nc1nc(-c2ccc(NC(C)=O)cc2)cs1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-3-28(26)18-7-5-4-6-16(18)19(25)23-20-22-17(12-27-20)14-8-10-15(11-9-14)21-13(2)24/h4-12H,3H2,1-2H3,(H,21,24)(H,22,23,25) |
| InChIKey | LNJMJPAMASMVNT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |