C21H24FNO3 — CID 112772148
2-(2-acetyl-4-fluorophenoxy)-N-(3-methyl-1-phenylbutyl)acetamide (PubChem CID 112772148) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-(2-acetyl-4-fluorophenoxy)-N-(3-methyl-1-phenylbutyl)acetamide.
| Compound Name | 2-(2-acetyl-4-fluorophenoxy)-N-(3-methyl-1-phenylbutyl)acetamide |
|---|---|
| PubChem CID | 112772148 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-(2-acetyl-4-fluorophenoxy)-N-(3-methyl-1-phenylbutyl)acetamide |
| SMILES | CC(=O)c1cc(F)ccc1OCC(=O)NC(CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H24FNO3/c1-14(2)11-19(16-7-5-4-6-8-16)23-21(25)13-26-20-10-9-17(22)12-18(20)15(3)24/h4-10,12,14,19H,11,13H2,1-3H3,(H,23,25) |
| InChIKey | GXBTUQTUFDVGMH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |