C17H16BrF2NO3 — CID 112772196
2-(3-bromophenoxy)-N-[2-[2-(difluoromethoxy)phenyl]ethyl]acetamide (PubChem CID 112772196) has the molecular formula C17H16BrF2NO3 and a molecular weight of 400.22 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[2-[2-(difluoromethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(3-bromophenoxy)-N-[2-[2-(difluoromethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 112772196 |
| Molecular Formula | C17H16BrF2NO3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[2-[2-(difluoromethoxy)phenyl]ethyl]acetamide |
| SMILES | O=C(COc1cccc(Br)c1)NCCc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H16BrF2NO3/c18-13-5-3-6-14(10-13)23-11-16(22)21-9-8-12-4-1-2-7-15(12)24-17(19)20/h1-7,10,17H,8-9,11H2,(H,21,22) |
| InChIKey | NHHSAAFUVZALPO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |