C22H20F2N4O4S — CID 112772324
3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxymethyl)-1,2,4-oxadiazole (PubChem CID 112772324) has the molecular formula C22H20F2N4O4S and a molecular weight of 474.49 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxymethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxymethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112772324 |
| Molecular Formula | C22H20F2N4O4S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-5-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxymethyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2noc(COc3ncnc4sc5c(c34)CCCCC5)n2)ccc1OC(F)F |
| InChI | InChI=1S/C22H20F2N4O4S/c1-29-15-9-12(7-8-14(15)31-22(23)24)19-27-17(32-28-19)10-30-20-18-13-5-3-2-4-6-16(13)33-21(18)26-11-25-20/h7-9,11,22H,2-6,10H2,1H3 |
| InChIKey | UBHNCTDRUGZTAL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |