C16H24ClNO2 — CID 112775393
2-(4-chloro-3-ethylphenoxy)-N,N-di(propan-2-yl)acetamide (PubChem CID 112775393) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 2-(4-chloro-3-ethylphenoxy)-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(4-chloro-3-ethylphenoxy)-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 112775393 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(4-chloro-3-ethylphenoxy)-N,N-di(propan-2-yl)acetamide |
| SMILES | CCc1cc(OCC(=O)N(C(C)C)C(C)C)ccc1Cl |
| InChI | InChI=1S/C16H24ClNO2/c1-6-13-9-14(7-8-15(13)17)20-10-16(19)18(11(2)3)12(4)5/h7-9,11-12H,6,10H2,1-5H3 |
| InChIKey | WHLUFHMVZCFNQG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |