C16H20O5 — CID 11277769
3-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 11277769) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | 3-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11277769 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[(2,2,4-trimethyl-6-oxo-1,3-dioxin-5-yl)methyl]-4,5,6,7-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CC1=C(CC2OC(=O)C3=C2CCCC3)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C16H20O5/c1-9-12(15(18)21-16(2,3)20-9)8-13-10-6-4-5-7-11(10)14(17)19-13/h13H,4-8H2,1-3H3 |
| InChIKey | BOMCJDDJFLXJFP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |