C18H17F3N2O4S — CID 112779762
2-[[2-(benzenesulfonyl)acetyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 112779762) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[[2-(benzenesulfonyl)acetyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[2-(benzenesulfonyl)acetyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 112779762 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[2-(benzenesulfonyl)acetyl]-methylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(F)(F)F)C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17F3N2O4S/c1-23(17(25)12-28(26,27)13-7-3-2-4-8-13)11-16(24)22-15-10-6-5-9-14(15)18(19,20)21/h2-10H,11-12H2,1H3,(H,22,24) |
| InChIKey | YBLMBQSTJAIYNC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |