C13H6ClF3O3 — CID 11278070
8-chloro-6-ethynyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11278070) has the molecular formula C13H6ClF3O3 and a molecular weight of 302.64 g/mol. Its IUPAC name is 8-chloro-6-ethynyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-chloro-6-ethynyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11278070 |
| Molecular Formula | C13H6ClF3O3 |
| Molecular Weight | 302.64 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 8-chloro-6-ethynyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | C#Cc1cc(Cl)c2c(c1)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H6ClF3O3/c1-2-6-3-7-5-8(12(18)19)11(13(15,16)17)20-10(7)9(14)4-6/h1,3-5,11H,(H,18,19) |
| InChIKey | XGSGQDRZXZOXAL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.64 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|