C25H20N4OS — CID 112783040
N-(cyanomethyl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-phenylacetamide (PubChem CID 112783040) has the molecular formula C25H20N4OS and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 112783040 |
| Molecular Formula | C25H20N4OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(cyanomethyl)-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-phenylacetamide |
| SMILES | N#CCN(C(=O)CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C25H20N4OS/c26-16-17-29(21-14-8-3-9-15-21)22(30)18-31-25-27-23(19-10-4-1-5-11-19)24(28-25)20-12-6-2-7-13-20/h1-15H,17-18H2,(H,27,28) |
| InChIKey | NMGYPWHSBRDFEH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|