C19H18FN3S2 — CID 112784148
3-cyclopropyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 112784148) has the molecular formula C19H18FN3S2 and a molecular weight of 371.51 g/mol. Its IUPAC name is 3-cyclopropyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-cyclopropyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112784148 |
| Molecular Formula | C19H18FN3S2 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 3-cyclopropyl-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | Fc1ccc(SCCSc2nnc(C3CC3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18FN3S2/c20-15-8-10-17(11-9-15)24-12-13-25-19-22-21-18(14-6-7-14)23(19)16-4-2-1-3-5-16/h1-5,8-11,14H,6-7,12-13H2 |
| InChIKey | WSZMDJONXKTGEE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|