C21H18ClN3O4S — CID 112786229
4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-6-ethyl-7-hydroxychromen-2-one (PubChem CID 112786229) has the molecular formula C21H18ClN3O4S and a molecular weight of 443.91 g/mol. Its IUPAC name is 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-6-ethyl-7-hydroxychromen-2-one.
| Compound Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-6-ethyl-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 112786229 |
| Molecular Formula | C21H18ClN3O4S |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 4-[[5-(5-chloro-2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-6-ethyl-7-hydroxychromen-2-one |
| SMILES | CCc1cc2c(CSc3n[nH]c(-c4cc(Cl)ccc4OC)n3)cc(=O)oc2cc1O |
| InChI | InChI=1S/C21H18ClN3O4S/c1-3-11-6-14-12(7-19(27)29-18(14)9-16(11)26)10-30-21-23-20(24-25-21)15-8-13(22)4-5-17(15)28-2/h4-9,26H,3,10H2,1-2H3,(H,23,24,25) |
| InChIKey | IKZKWEFENDKAEJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|