C22H19N5O5 — CID 112788610
5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 112788610) has the molecular formula C22H19N5O5 and a molecular weight of 433.42 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112788610 |
| Molecular Formula | C22H19N5O5 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-3-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)CCC3)NC(=O)N(Cc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)C1=O |
| InChI | InChI=1S/C22H19N5O5/c1-22(16-8-5-13-3-2-4-15(13)11-16)20(28)26(21(29)23-22)12-18-24-25-19(32-18)14-6-9-17(10-7-14)27(30)31/h5-11H,2-4,12H2,1H3,(H,23,29) |
| InChIKey | LCTXJMBERXEBMS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|