C19H15N5O5S — CID 112788366
3'-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 112788366) has the molecular formula C19H15N5O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is 3'-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 112788366 |
| Molecular Formula | C19H15N5O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3'-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC2(CCCc3sccc32)C(=O)N1Cc1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H15N5O5S/c25-17-19(8-1-2-14-13(19)7-9-30-14)20-18(26)23(17)10-15-21-22-16(29-15)11-3-5-12(6-4-11)24(27)28/h3-7,9H,1-2,8,10H2,(H,20,26) |
| InChIKey | ABPBWWNEGDQUQQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|