C28H25N3O — CID 112788926
N-[2-(1H-indol-3-yl)ethyl]-2-(2-methyl-4-phenylquinolin-3-yl)acetamide (PubChem CID 112788926) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-(2-methyl-4-phenylquinolin-3-yl)acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-(2-methyl-4-phenylquinolin-3-yl)acetamide |
|---|---|
| PubChem CID | 112788926 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-(2-methyl-4-phenylquinolin-3-yl)acetamide |
| SMILES | Cc1nc2ccccc2c(-c2ccccc2)c1CC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H25N3O/c1-19-24(17-27(32)29-16-15-21-18-30-25-13-7-5-11-22(21)25)28(20-9-3-2-4-10-20)23-12-6-8-14-26(23)31-19/h2-14,18,30H,15-17H2,1H3,(H,29,32) |
| InChIKey | IHAQNZWZSCBJLB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |