C24H28N2O5P- — CID 154030021
3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]propyl propan-2-yl phosphate (PubChem CID 154030021) has the molecular formula C24H28N2O5P- and a molecular weight of 455.47 g/mol. Its IUPAC name is 3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]propyl propan-2-yl phosphate.
| Compound Name | 3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]propyl propan-2-yl phosphate |
|---|---|
| PubChem CID | 154030021 |
| Molecular Formula | C24H28N2O5P- |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 3-[[2-(2-methyl-4-phenylquinolin-3-yl)acetyl]amino]propyl propan-2-yl phosphate |
| SMILES | Cc1nc2ccccc2c(-c2ccccc2)c1CC(=O)NCCCOP(=O)([O-])OC(C)C |
| InChI | InChI=1S/C24H29N2O5P/c1-17(2)31-32(28,29)30-15-9-14-25-23(27)16-21-18(3)26-22-13-8-7-12-20(22)24(21)19-10-5-4-6-11-19/h4-8,10-13,17H,9,14-16H2,1-3H3,(H,25,27)(H,28,29)/p-1 |
| InChIKey | SMXAYZZIAGBERM-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|