C25H30NO5P — CID 122435992
4-[[2-(1-phenylnaphthalen-2-yl)acetyl]amino]butyl propan-2-yl hydrogen phosphate (PubChem CID 122435992) has the molecular formula C25H30NO5P and a molecular weight of 455.49 g/mol. Its IUPAC name is 4-[[2-(1-phenylnaphthalen-2-yl)acetyl]amino]butyl propan-2-yl hydrogen phosphate.
| Compound Name | 4-[[2-(1-phenylnaphthalen-2-yl)acetyl]amino]butyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 122435992 |
| Molecular Formula | C25H30NO5P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[[2-(1-phenylnaphthalen-2-yl)acetyl]amino]butyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OCCCCNC(=O)Cc1ccc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C25H30NO5P/c1-19(2)31-32(28,29)30-17-9-8-16-26-24(27)18-22-15-14-20-10-6-7-13-23(20)25(22)21-11-4-3-5-12-21/h3-7,10-15,19H,8-9,16-18H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | PCJBUVYVPZLUKZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|