C18H25N2O5P — CID 122500442
4-[(2-isoquinolin-3-ylacetyl)amino]butyl propan-2-yl hydrogen phosphate (PubChem CID 122500442) has the molecular formula C18H25N2O5P and a molecular weight of 380.38 g/mol. Its IUPAC name is 4-[(2-isoquinolin-3-ylacetyl)amino]butyl propan-2-yl hydrogen phosphate.
| Compound Name | 4-[(2-isoquinolin-3-ylacetyl)amino]butyl propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 122500442 |
| Molecular Formula | C18H25N2O5P |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-[(2-isoquinolin-3-ylacetyl)amino]butyl propan-2-yl hydrogen phosphate |
| SMILES | CC(C)OP(=O)(O)OCCCCNC(=O)Cc1cc2ccccc2cn1 |
| InChI | InChI=1S/C18H25N2O5P/c1-14(2)25-26(22,23)24-10-6-5-9-19-18(21)12-17-11-15-7-3-4-8-16(15)13-20-17/h3-4,7-8,11,13-14H,5-6,9-10,12H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | GWWPITBMYQXUKV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|