C27H36N2O6P- — CID 159690152
4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl propan-2-yl phosphate;methane (PubChem CID 159690152) has the molecular formula C27H36N2O6P- and a molecular weight of 515.57 g/mol. Its IUPAC name is 4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl propan-2-yl phosphate;methane.
| Compound Name | 4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl propan-2-yl phosphate;methane |
|---|---|
| PubChem CID | 159690152 |
| Molecular Formula | C27H36N2O6P- |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl propan-2-yl phosphate;methane |
| SMILES | C.CC(C)OP(=O)([O-])OCCCCNC(=O)Cc1cnc2c(CCO)cccc2c1-c1ccccc1 |
| InChI | InChI=1S/C26H33N2O6P.CH4/c1-19(2)34-35(31,32)33-16-7-6-14-27-24(30)17-22-18-28-26-21(13-15-29)11-8-12-23(26)25(22)20-9-4-3-5-10-20;/h3-5,8-12,18-19,29H,6-7,13-17H2,1-2H3,(H,27,30)(H,31,32);1H4/p-1 |
| InChIKey | MWHOMXRSPSPGOM-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|