C24H28N2O2 — CID 144823376
N-(4-hydroxybutyl)-2-(4-phenyl-8-propylquinolin-3-yl)acetamide (PubChem CID 144823376) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2-(4-phenyl-8-propylquinolin-3-yl)acetamide.
| Compound Name | N-(4-hydroxybutyl)-2-(4-phenyl-8-propylquinolin-3-yl)acetamide |
|---|---|
| PubChem CID | 144823376 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-(4-hydroxybutyl)-2-(4-phenyl-8-propylquinolin-3-yl)acetamide |
| SMILES | CCCc1cccc2c(-c3ccccc3)c(CC(=O)NCCCCO)cnc12 |
| InChI | InChI=1S/C24H28N2O2/c1-2-9-19-12-8-13-21-23(18-10-4-3-5-11-18)20(17-26-24(19)21)16-22(28)25-14-6-7-15-27/h3-5,8,10-13,17,27H,2,6-7,9,14-16H2,1H3,(H,25,28) |
| InChIKey | NOOCCNJTKLWZJE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|