C21H21NO3 — CID 146289919
ethyl 2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetate (PubChem CID 146289919) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethyl 2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetate.
| Compound Name | ethyl 2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 146289919 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | ethyl 2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cnc2c(CCO)cccc2c1-c1ccccc1 |
| InChI | InChI=1S/C21H21NO3/c1-2-25-19(24)13-17-14-22-21-16(11-12-23)9-6-10-18(21)20(17)15-7-4-3-5-8-15/h3-10,14,23H,2,11-13H2,1H3 |
| InChIKey | OXCCCBGTEXBUOC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |