C24H28N2O6P- — CID 142561670
4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl methyl phosphate (PubChem CID 142561670) has the molecular formula C24H28N2O6P- and a molecular weight of 471.47 g/mol. Its IUPAC name is 4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl methyl phosphate.
| Compound Name | 4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl methyl phosphate |
|---|---|
| PubChem CID | 142561670 |
| Molecular Formula | C24H28N2O6P- |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 4-[[2-[8-(2-hydroxyethyl)-4-phenylquinolin-3-yl]acetyl]amino]butyl methyl phosphate |
| SMILES | COP(=O)([O-])OCCCCNC(=O)Cc1cnc2c(CCO)cccc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H29N2O6P/c1-31-33(29,30)32-15-6-5-13-25-22(28)16-20-17-26-24-19(12-14-27)10-7-11-21(24)23(20)18-8-3-2-4-9-18/h2-4,7-11,17,27H,5-6,12-16H2,1H3,(H,25,28)(H,29,30)/p-1 |
| InChIKey | PFTBULKVAKOHMK-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 120.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|