C25H30N2O3 — CID 123824387
N-butyl-2-[4-[3-(3,4-dihydroxybutyl)phenyl]quinolin-3-yl]acetamide (PubChem CID 123824387) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-butyl-2-[4-[3-(3,4-dihydroxybutyl)phenyl]quinolin-3-yl]acetamide.
| Compound Name | N-butyl-2-[4-[3-(3,4-dihydroxybutyl)phenyl]quinolin-3-yl]acetamide |
|---|---|
| PubChem CID | 123824387 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-butyl-2-[4-[3-(3,4-dihydroxybutyl)phenyl]quinolin-3-yl]acetamide |
| SMILES | CCCCNC(=O)Cc1cnc2ccccc2c1-c1cccc(CCC(O)CO)c1 |
| InChI | InChI=1S/C25H30N2O3/c1-2-3-13-26-24(30)15-20-16-27-23-10-5-4-9-22(23)25(20)19-8-6-7-18(14-19)11-12-21(29)17-28/h4-10,14,16,21,28-29H,2-3,11-13,15,17H2,1H3,(H,26,30) |
| InChIKey | WAXNVZKRAYVUGJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|