About 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid
2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid (PubChem CID 125492607) has the molecular formula C21H21NO4
and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid |
| PubChem CID | 125492607 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cnc2ccccc2c1-c1cccc(CC[C@@H](O)CO)c1 |
| InChI | InChI=1S/C21H21NO4/c23-13-17(24)9-8-14-4-3-5-15(10-14)21-16(11-20(25)26)12-22-19-7-2-1-6-18(19)21/h1-7,10,12,17,23-24H,8-9,11,13H2,(H,25,26)/t17-/m1/s1 |
| InChIKey | QPWLVKVBNCIDTJ-QGZVFWFLSA-N |
| XLogP | 2.81 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid?
The IUPAC name of 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid (CID 125492607) is 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid.
What is the SMILES notation for 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid?
The canonical SMILES for 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid is O=C(O)Cc1cnc2ccccc2c1-c1cccc(CC[C@@H](O)CO)c1.
What is the InChIKey of 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid?
The InChIKey is QPWLVKVBNCIDTJ-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H21NO4/c23-13-17(24)9-8-14-4-3-5-15(10-14)21-16(11-20(25)26)12-22-19-7-2-1-6-18(19)21/h1-7,10,12,17,23-24H,8-9,11,13H2,(H,25,26)/t17-/m1/s1.
What are the key properties of 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid?
2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid has a molecular weight of 351.40 g/mol, XLogP of 2.81, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid is sourced from PubChem (CID 125492607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).