C21H21NO4 — CID 125492607
2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid (PubChem CID 125492607) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 125492607 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[4-[3-[(3R)-3,4-dihydroxybutyl]phenyl]quinolin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cnc2ccccc2c1-c1cccc(CC[C@@H](O)CO)c1 |
| InChI | InChI=1S/C21H21NO4/c23-13-17(24)9-8-14-4-3-5-15(10-14)21-16(11-20(25)26)12-22-19-7-2-1-6-18(19)21/h1-7,10,12,17,23-24H,8-9,11,13H2,(H,25,26)/t17-/m1/s1 |
| InChIKey | QPWLVKVBNCIDTJ-QGZVFWFLSA-N |
| XLogP | 2.81 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |