C32H35NO6P- — CID 158057478
[6-oxo-7-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]heptyl] propan-2-yl phosphate (PubChem CID 158057478) has the molecular formula C32H35NO6P- and a molecular weight of 560.61 g/mol. Its IUPAC name is [6-oxo-7-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]heptyl] propan-2-yl phosphate.
| Compound Name | [6-oxo-7-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]heptyl] propan-2-yl phosphate |
|---|---|
| PubChem CID | 158057478 |
| Molecular Formula | C32H35NO6P- |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [6-oxo-7-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]heptyl] propan-2-yl phosphate |
| SMILES | CC(C)OP(=O)([O-])OCCCCCC(=O)Cc1cnc2ccccc2c1-c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H36NO6P/c1-24(2)39-40(35,36)38-19-10-4-7-15-28(34)20-27-22-33-31-18-9-8-17-30(31)32(27)26-14-11-16-29(21-26)37-23-25-12-5-3-6-13-25/h3,5-6,8-9,11-14,16-18,21-22,24H,4,7,10,15,19-20,23H2,1-2H3,(H,35,36)/p-1 |
| InChIKey | FKFRPNHKGHFMGA-UHFFFAOYSA-M |
| XLogP | 7.06 |
| TPSA | 97.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|