C24H28NO4PS — CID 147040689
6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-1-(4-phenylisoquinolin-3-yl)hexan-2-one (PubChem CID 147040689) has the molecular formula C24H28NO4PS and a molecular weight of 457.53 g/mol. Its IUPAC name is 6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-1-(4-phenylisoquinolin-3-yl)hexan-2-one.
| Compound Name | 6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-1-(4-phenylisoquinolin-3-yl)hexan-2-one |
|---|---|
| PubChem CID | 147040689 |
| Molecular Formula | C24H28NO4PS |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-1-(4-phenylisoquinolin-3-yl)hexan-2-one |
| SMILES | CC(C)OP(O)(=S)OCCCCC(=O)Cc1ncc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H28NO4PS/c1-18(2)29-30(27,31)28-15-9-8-13-21(26)16-23-24(19-10-4-3-5-11-19)22-14-7-6-12-20(22)17-25-23/h3-7,10-12,14,17-18H,8-9,13,15-16H2,1-2H3,(H,27,31) |
| InChIKey | AZJWFSCDVWGNGU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|