C12H28NO3PS — CID 176838194
6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-N-propan-2-ylhexan-1-amine (PubChem CID 176838194) has the molecular formula C12H28NO3PS and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-N-propan-2-ylhexan-1-amine.
| Compound Name | 6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-N-propan-2-ylhexan-1-amine |
|---|---|
| PubChem CID | 176838194 |
| Molecular Formula | C12H28NO3PS |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 6-[hydroxy(propan-2-yloxy)phosphinothioyl]oxy-N-propan-2-ylhexan-1-amine |
| SMILES | CC(C)NCCCCCCOP(O)(=S)OC(C)C |
| InChI | InChI=1S/C12H28NO3PS/c1-11(2)13-9-7-5-6-8-10-15-17(14,18)16-12(3)4/h11-13H,5-10H2,1-4H3,(H,14,18) |
| InChIKey | ZTCQWPJIZMMUMG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|