C14H32NO4PS — CID 156747547
N-[6-[methoxy(propan-2-yloxy)phosphinothioyl]oxyhexyl]-2-methylpropanamide;molecular hydrogen (PubChem CID 156747547) has the molecular formula C14H32NO4PS and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[6-[methoxy(propan-2-yloxy)phosphinothioyl]oxyhexyl]-2-methylpropanamide;molecular hydrogen.
| Compound Name | N-[6-[methoxy(propan-2-yloxy)phosphinothioyl]oxyhexyl]-2-methylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 156747547 |
| Molecular Formula | C14H32NO4PS |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[6-[methoxy(propan-2-yloxy)phosphinothioyl]oxyhexyl]-2-methylpropanamide;molecular hydrogen |
| SMILES | COP(=S)(OCCCCCCNC(=O)C(C)C)OC(C)C.[H][H] |
| InChI | InChI=1S/C14H30NO4PS.H2/c1-12(2)14(16)15-10-8-6-7-9-11-18-20(21,17-5)19-13(3)4;/h12-13H,6-11H2,1-5H3,(H,15,16);1H |
| InChIKey | PQFFTMKVZOAIRJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|