C14H34NO5P — CID 168888477
6-acetamidohexyl methyl propan-2-yl phosphate;ethane;molecular hydrogen (PubChem CID 168888477) has the molecular formula C14H34NO5P and a molecular weight of 327.40 g/mol. Its IUPAC name is 6-acetamidohexyl methyl propan-2-yl phosphate;ethane;molecular hydrogen.
| Compound Name | 6-acetamidohexyl methyl propan-2-yl phosphate;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 168888477 |
| Molecular Formula | C14H34NO5P |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 6-acetamidohexyl methyl propan-2-yl phosphate;ethane;molecular hydrogen |
| SMILES | CC.COP(=O)(OCCCCCCNC(C)=O)OC(C)C.[H][H] |
| InChI | InChI=1S/C12H26NO5P.C2H6.H2/c1-11(2)18-19(15,16-4)17-10-8-6-5-7-9-13-12(3)14;1-2;/h11H,5-10H2,1-4H3,(H,13,14);1-2H3;1H |
| InChIKey | BITYONJMOSTJRC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|