C14H30N2O11P2 — CID 23399697
1,3-diacetamidopropan-2-yl 2-(2-dimethoxyphosphoryloxyethoxy)ethyl methyl phosphate (PubChem CID 23399697) has the molecular formula C14H30N2O11P2 and a molecular weight of 464.35 g/mol. Its IUPAC name is 1,3-diacetamidopropan-2-yl 2-(2-dimethoxyphosphoryloxyethoxy)ethyl methyl phosphate.
| Compound Name | 1,3-diacetamidopropan-2-yl 2-(2-dimethoxyphosphoryloxyethoxy)ethyl methyl phosphate |
|---|---|
| PubChem CID | 23399697 |
| Molecular Formula | C14H30N2O11P2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1,3-diacetamidopropan-2-yl 2-(2-dimethoxyphosphoryloxyethoxy)ethyl methyl phosphate |
| SMILES | COP(=O)(OC)OCCOCCOP(=O)(OC)OC(CNC(C)=O)CNC(C)=O |
| InChI | InChI=1S/C14H30N2O11P2/c1-12(17)15-10-14(11-16-13(2)18)27-29(20,23-5)26-9-7-24-6-8-25-28(19,21-3)22-4/h14H,6-11H2,1-5H3,(H,15,17)(H,16,18) |
| InChIKey | RVZFLCNDGRGOTL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 156.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|