C33H37NO6P- — CID 149369994
[7-oxo-8-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]octyl] propan-2-yl phosphate (PubChem CID 149369994) has the molecular formula C33H37NO6P- and a molecular weight of 574.63 g/mol. Its IUPAC name is [7-oxo-8-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]octyl] propan-2-yl phosphate.
| Compound Name | [7-oxo-8-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]octyl] propan-2-yl phosphate |
|---|---|
| PubChem CID | 149369994 |
| Molecular Formula | C33H37NO6P- |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | [7-oxo-8-[4-(3-phenylmethoxyphenyl)quinolin-3-yl]octyl] propan-2-yl phosphate |
| SMILES | CC(C)OP(=O)([O-])OCCCCCCC(=O)Cc1cnc2ccccc2c1-c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H38NO6P/c1-25(2)40-41(36,37)39-20-11-4-3-8-16-29(35)21-28-23-34-32-19-10-9-18-31(32)33(28)27-15-12-17-30(22-27)38-24-26-13-6-5-7-14-26/h5-7,9-10,12-15,17-19,22-23,25H,3-4,8,11,16,20-21,24H2,1-2H3,(H,36,37)/p-1 |
| InChIKey | YJPMYAZZRYSDJC-UHFFFAOYSA-M |
| XLogP | 7.45 |
| TPSA | 97.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|