C25H37N2O5P — CID 144823006
ethane;methyl 4-[[2-(2-methyl-4-phenyl-6,7-dihydroquinolin-3-yl)acetyl]amino]butyl hydrogen phosphate;molecular hydrogen (PubChem CID 144823006) has the molecular formula C25H37N2O5P and a molecular weight of 476.55 g/mol. Its IUPAC name is ethane;methyl 4-[[2-(2-methyl-4-phenyl-6,7-dihydroquinolin-3-yl)acetyl]amino]butyl hydrogen phosphate;molecular hydrogen.
| Compound Name | ethane;methyl 4-[[2-(2-methyl-4-phenyl-6,7-dihydroquinolin-3-yl)acetyl]amino]butyl hydrogen phosphate;molecular hydrogen |
|---|---|
| PubChem CID | 144823006 |
| Molecular Formula | C25H37N2O5P |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | ethane;methyl 4-[[2-(2-methyl-4-phenyl-6,7-dihydroquinolin-3-yl)acetyl]amino]butyl hydrogen phosphate;molecular hydrogen |
| SMILES | CC.COP(=O)(O)OCCCCNC(=O)Cc1c(C)nc2c(c1-c1ccccc1)=CCCC=2.[H][H] |
| InChI | InChI=1S/C23H29N2O5P.C2H6.H2/c1-17-20(16-22(26)24-14-8-9-15-30-31(27,28)29-2)23(18-10-4-3-5-11-18)19-12-6-7-13-21(19)25-17;1-2;/h3-5,10-13H,6-9,14-16H2,1-2H3,(H,24,26)(H,27,28);1-2H3;1H |
| InChIKey | QQALYARZWOSAID-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|