C20H16Br2O3 — CID 13373699
ethyl 2-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxyacetate (PubChem CID 13373699) has the molecular formula C20H16Br2O3 and a molecular weight of 464.15 g/mol. Its IUPAC name is ethyl 2-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxyacetate.
| Compound Name | ethyl 2-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxyacetate |
|---|---|
| PubChem CID | 13373699 |
| Molecular Formula | C20H16Br2O3 |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 461.95 |
| IUPAC Name | ethyl 2-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxyacetate |
| SMILES | CCOC(=O)COc1c(Br)c(Br)c(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C20H16Br2O3/c1-2-24-16(23)12-25-20-15-11-7-6-10-14(15)17(18(21)19(20)22)13-8-4-3-5-9-13/h3-11H,2,12H2,1H3 |
| InChIKey | HXLNUXGHMACUOO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |