C19H15Br2ClO2 — CID 13158229
1-chloro-3-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxypropan-2-ol (PubChem CID 13158229) has the molecular formula C19H15Br2ClO2 and a molecular weight of 470.59 g/mol. Its IUPAC name is 1-chloro-3-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxypropan-2-ol.
| Compound Name | 1-chloro-3-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 13158229 |
| Molecular Formula | C19H15Br2ClO2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 467.91 |
| IUPAC Name | 1-chloro-3-(2,3-dibromo-4-phenylnaphthalen-1-yl)oxypropan-2-ol |
| SMILES | OC(CCl)COc1c(Br)c(Br)c(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C19H15Br2ClO2/c20-17-16(12-6-2-1-3-7-12)14-8-4-5-9-15(14)19(18(17)21)24-11-13(23)10-22/h1-9,13,23H,10-11H2 |
| InChIKey | SPHOFGFQHACULT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|