C47H57N3O10P2 — CID 102255849
6-[[6-[6-[2,2-diphenylethoxy(hydroxy)phosphoryl]oxyhexylcarbamoyl]pyridine-2-carbonyl]amino]hexyl 2,2-diphenylethyl hydrogen phosphate (PubChem CID 102255849) has the molecular formula C47H57N3O10P2 and a molecular weight of 885.93 g/mol. Its IUPAC name is 6-[[6-[6-[2,2-diphenylethoxy(hydroxy)phosphoryl]oxyhexylcarbamoyl]pyridine-2-carbonyl]amino]hexyl 2,2-diphenylethyl hydrogen phosphate.
| Compound Name | 6-[[6-[6-[2,2-diphenylethoxy(hydroxy)phosphoryl]oxyhexylcarbamoyl]pyridine-2-carbonyl]amino]hexyl 2,2-diphenylethyl hydrogen phosphate |
|---|---|
| PubChem CID | 102255849 |
| Molecular Formula | C47H57N3O10P2 |
| Molecular Weight | 885.93 g/mol |
| Exact Mass | 885.35 |
| IUPAC Name | 6-[[6-[6-[2,2-diphenylethoxy(hydroxy)phosphoryl]oxyhexylcarbamoyl]pyridine-2-carbonyl]amino]hexyl 2,2-diphenylethyl hydrogen phosphate |
| SMILES | O=C(NCCCCCCOP(=O)(O)OCC(c1ccccc1)c1ccccc1)c1cccc(C(=O)NCCCCCCOP(=O)(O)OCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C47H57N3O10P2/c51-46(48-32-17-1-3-19-34-57-61(53,54)59-36-42(38-22-9-5-10-23-38)39-24-11-6-12-25-39)44-30-21-31-45(50-44)47(52)49-33-18-2-4-20-35-58-62(55,56)60-37-43(40-26-13-7-14-27-40)41-28-15-8-16-29-41/h5-16,21-31,42-43H,1-4,17-20,32-37H2,(H,48,51)(H,49,52)(H,53,54)(H,55,56) |
| InChIKey | ZIKQNLGVPXFIOQ-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 182.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.93 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|