C17H27N3O4 — CID 142043508
6-N-(3-butan-2-yloxypropyl)-2-N-(3-hydroxypropyl)pyridine-2,6-dicarboxamide (PubChem CID 142043508) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-N-(3-butan-2-yloxypropyl)-2-N-(3-hydroxypropyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-(3-butan-2-yloxypropyl)-2-N-(3-hydroxypropyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 142043508 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 6-N-(3-butan-2-yloxypropyl)-2-N-(3-hydroxypropyl)pyridine-2,6-dicarboxamide |
| SMILES | CCC(C)OCCCNC(=O)c1cccc(C(=O)NCCCO)n1 |
| InChI | InChI=1S/C17H27N3O4/c1-3-13(2)24-12-6-10-19-17(23)15-8-4-7-14(20-15)16(22)18-9-5-11-21/h4,7-8,13,21H,3,5-6,9-12H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | CCGJHMVOIKHKCC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|