C20H21NO4 — CID 11279204
dimethyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate (PubChem CID 11279204) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is dimethyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11279204 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | dimethyl (2R,4S,5R)-1,5-diphenylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](C(=O)OC)N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H21NO4/c1-24-19(22)16-13-17(20(23)25-2)21(15-11-7-4-8-12-15)18(16)14-9-5-3-6-10-14/h3-12,16-18H,13H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | LSDUDZIWWUZLQE-KSZLIROESA-N |
| XLogP | 2.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |