C18H24O5S — CID 11279615
cis-diethyl (3S,4S)-3-hydroxy-3-methyl-4-(1-thiophen-2-ylethenyl)cyclopentane-1,1-dicarboxylate (PubChem CID 11279615) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is cis-diethyl (3S,4S)-3-hydroxy-3-methyl-4-(1-thiophen-2-ylethenyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | cis-diethyl (3S,4S)-3-hydroxy-3-methyl-4-(1-thiophen-2-ylethenyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11279615 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | cis-diethyl (3S,4S)-3-hydroxy-3-methyl-4-(1-thiophen-2-ylethenyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(c1cccs1)[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@]1(C)O |
| InChI | InChI=1S/C18H24O5S/c1-5-22-15(19)18(16(20)23-6-2)10-13(17(4,21)11-18)12(3)14-8-7-9-24-14/h7-9,13,21H,3,5-6,10-11H2,1-2,4H3/t13-,17-/m0/s1 |
| InChIKey | DEFZNNOGBSLOHI-GUYCJALGSA-N |
| XLogP | 3.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|