C22H23N3O3S — CID 112796351
methyl 2-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 112796351) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is methyl 2-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | methyl 2-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 112796351 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 2-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2CN1Cc1nnc(-c2cc3c(s2)CCCC3)o1 |
| InChI | InChI=1S/C22H23N3O3S/c1-27-22(26)17-10-14-6-2-3-8-16(14)12-25(17)13-20-23-24-21(28-20)19-11-15-7-4-5-9-18(15)29-19/h2-3,6,8,11,17H,4-5,7,9-10,12-13H2,1H3 |
| InChIKey | XDOPPIDANRNDSD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |